cas: 15964-80-4 — see every product listed under this CAS number, including other names
Methyl 2-(4-hydroxy-3-methoxyphenyl)acetate, 97% (CAS 15964-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693328-250MG |
| cas | 15964-80-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 440.49 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1825.42 Pln | |
| Fluorochem | 10g | 3413.40 Pln | |
| Fluorochem | 25g | 6714.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-(4-hydroxy-3-methoxyphenyl)acetate (CAS 15964-80-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2-(4-hydroxy-3-methoxyphenyl)acetate. InChIKey: JJJSFAGPWHEUBT-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2-(4-hydroxy-3-methoxyphenyl)acetate |
| InChIKey | JJJSFAGPWHEUBT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(=O)OC)O |
Computed by PubChem (NCBI)