cas: 163160-56-3 — see every product listed under this CAS number, including other names
Methyl 2-(5-bromo-1H-indol-3-yl)-2-oxoacetate, 95+% (CAS 163160-56-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A464439-5g |
| cas | 163160-56-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8161.93 Pln | |
| AmBeed | 25g | 9861.04 Pln | |
| AmBeed | 250mg | 2778.16 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-(5-bromo-1H-indol-3-yl)-2-oxoacetate (CAS 163160-56-3) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 2-(5-bromo-1H-indol-3-yl)-2-oxoacetate. InChIKey: DHPHYKMALRMWJY-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 2-(5-bromo-1H-indol-3-yl)-2-oxoacetate |
| InChIKey | DHPHYKMALRMWJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CNC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)