CAS 1593717-84-0 is the registry number for 6-Bromo-4-hydroxy-quinoline-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 6-bromo-4-oxo-1H-quinoline-3-carboxylate (CAS 1593717-84-0) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 6-bromo-4-oxo-1H-quinoline-3-carboxylate. InChIKey: YMTSLYINOPYVFO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 6-bromo-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | YMTSLYINOPYVFO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)