CAS 123856-15-5 is the registry number for 6-Bromo-2-methoxy-1-nitronaphthalene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 25g.
6-bromo-2-methoxy-1-nitronaphthalene (CAS 123856-15-5) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: 6-bromo-2-methoxy-1-nitronaphthalene. InChIKey: VQUIAHIZENASND-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 6-bromo-2-methoxy-1-nitronaphthalene |
| InChIKey | VQUIAHIZENASND-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)