cas: 668262-52-0 — see every product listed under this CAS number, including other names
Methyl 2-(bromomethyl)-5-chlorobenzoate 98% (CAS 668262-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144919-250mg |
| cas | 668262-52-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144919 |
Methyl 2-(bromomethyl)-5-chlorobenzoate (CAS 668262-52-0) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-chlorobenzoate. InChIKey: PVGXSSGKABOXTL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-chlorobenzoate |
| InChIKey | PVGXSSGKABOXTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)CBr |
Computed by PubChem (NCBI)