cas: 668262-52-0 — see every product listed under this CAS number, including other names
methyl 2-(bromomethyl)-5-chlorobenzoate, 97%, 97% (CAS 668262-52-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDZA-100mg |
| cas | 668262-52-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(bromomethyl)-5-chlorobenzoate (CAS 668262-52-0) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-chlorobenzoate. InChIKey: PVGXSSGKABOXTL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-chlorobenzoate |
| InChIKey | PVGXSSGKABOXTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)CBr |
Computed by PubChem (NCBI)