Methyl 2-(bromomethyl)-5-methoxybenzoate, 95%
cas: 788081-99-2 — see every product listed under this CAS number, including other names
Methyl 2-(bromomethyl)-5-methoxybenzoate, 95% (CAS 788081-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A308405-100mg |
| cas | 788081-99-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1377.19 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1379.60 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 475.41 Pln | |
| BLDpharm | 5g | 1480.61 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 2559.53 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-(bromomethyl)-5-methoxybenzoate (CAS 788081-99-2) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-methoxybenzoate. InChIKey: GQGYGEVWBRHRTD-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-methoxybenzoate |
| InChIKey | GQGYGEVWBRHRTD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CBr)C(=O)OC |
Computed by PubChem (NCBI)