cas: 50735-34-7 — see every product listed under this CAS number, including other names
Methyl 2-Amino-5-bromonicotinate, 97% (CAS 50735-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066900-1G |
| cas | 50735-34-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 581.06 Pln | |
| Fluorochem | 500g | 2231.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-5-bromopyridine-3-carboxylate (CAS 50735-34-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: methyl 2-amino-5-bromopyridine-3-carboxylate. InChIKey: POWKBBOOIZBIRZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | methyl 2-amino-5-bromopyridine-3-carboxylate |
| InChIKey | POWKBBOOIZBIRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)