cas: 50735-34-7 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-bromopyridine-3-carboxylate, 95%, 95% (CAS 50735-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RMW-1g |
| cas | 50735-34-7 |
| size | 1g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 482.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-5-bromopyridine-3-carboxylate (CAS 50735-34-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: methyl 2-amino-5-bromopyridine-3-carboxylate. InChIKey: POWKBBOOIZBIRZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | methyl 2-amino-5-bromopyridine-3-carboxylate |
| InChIKey | POWKBBOOIZBIRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)