cas: 1795232-59-5 — see every product listed under this CAS number, including other names
Methyl 2-Bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate, 98%, 98% (CAS 1795232-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL1W-100mg |
| cas | 1795232-59-5 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate (CAS 1795232-59-5) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate. InChIKey: HRKNVEBXWJDVFK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | methyl 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate |
| InChIKey | HRKNVEBXWJDVFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=NC(=N2)Br)C=C1 |
Computed by PubChem (NCBI)