CAS 1858255-52-3 is the registry number for 5-Bromo-4-methyl-7-nitro-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-bromo-4-methyl-7-nitro-1H-indazole (CAS 1858255-52-3) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 5-bromo-4-methyl-7-nitro-1H-indazole. InChIKey: IRWIMKYSTQZEKJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 5-bromo-4-methyl-7-nitro-1H-indazole |
| InChIKey | IRWIMKYSTQZEKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C2=C1C=NN2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)