CAS 1072944-64-9 is the registry number for 6-Bromo-7-methyl-3-nitroimidazo[1,2-a]pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
6-bromo-7-methyl-3-nitroimidazo[1,2-a]pyridine (CAS 1072944-64-9) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 6-bromo-7-methyl-3-nitroimidazo[1,2-a]pyridine. InChIKey: YNWPOCXNUADNQD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 6-bromo-7-methyl-3-nitroimidazo[1,2-a]pyridine |
| InChIKey | YNWPOCXNUADNQD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(N2C=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)