Methyl 2-acetyl-3-hydroxybenzoate, 98%
cas: 370553-41-6 — see every product listed under this CAS number, including other names
Methyl 2-acetyl-3-hydroxybenzoate, 98% (CAS 370553-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1708531-100mg |
| cas | 370553-41-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3218.38 Pln | |
| Ambeed | 10g | 5832.75 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 1014.11 Pln | |
| BLDpharm | 5g | 3602.09 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 966.34 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-acetyl-3-hydroxybenzoate (CAS 370553-41-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl 2-acetyl-3-hydroxybenzoate. InChIKey: YLGAWYQBSGMTLX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl 2-acetyl-3-hydroxybenzoate |
| InChIKey | YLGAWYQBSGMTLX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC=C1O)C(=O)OC |
Computed by PubChem (NCBI)