cas: 363185-87-9 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 96% (CAS 363185-87-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222981-250MG |
| cas | 363185-87-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1013.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 363185-87-9) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: DQZPCTKBZUCRNT-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | methyl 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | DQZPCTKBZUCRNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)C(=O)OC |
Computed by PubChem (NCBI)