cas: 312295-61-7 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-(trifluoromethoxy)benzoate 95% (CAS 312295-61-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331439-100mg |
| cas | 312295-61-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 798.69 Pln | |
| Ambeed | 1g | 2094.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A331439 |
Methyl 2-amino-5-(trifluoromethoxy)benzoate (CAS 312295-61-7) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: methyl 2-amino-5-(trifluoromethoxy)benzoate. InChIKey: OGILFWCKESKAAY-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | methyl 2-amino-5-(trifluoromethoxy)benzoate |
| InChIKey | OGILFWCKESKAAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)