Products 851045-82-4
CAS 851045-82-4 appears in our catalog under these names: Methyl 2-amino-3-(trifluoromethoxy)benzoate, 95%, Methyl 2-amino-3-(trifluoromethoxy)benzoate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 2-amino-3-(trifluoromethoxy)benzoate (CAS 851045-82-4) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: methyl 2-amino-3-(trifluoromethoxy)benzoate. InChIKey: YJXGGECNRJYPDZ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | methyl 2-amino-3-(trifluoromethoxy)benzoate |
| InChIKey | YJXGGECNRJYPDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)