Products 1227594-91-3
CAS 1227594-91-3 is the registry number for Methyl 2-methoxy-6-(trifluoromethyl)isonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylate (CAS 1227594-91-3) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: methyl 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylate. InChIKey: IMULAOHQPIYUDB-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | methyl 2-methoxy-6-(trifluoromethyl)pyridine-4-carboxylate |
| InChIKey | IMULAOHQPIYUDB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)