cas: 117324-58-0 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-(trifluoromethyl)benzoate 98% (CAS 117324-58-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165034-1000g |
| cas | 117324-58-0 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 17664.19 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 303.62 Pln | |
| Ambeed | 25g | 654.06 Pln | |
| Ambeed | 100g | 2267.19 Pln | |
| Ambeed | 500g | 11061.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165034 |
Methyl 2-amino-5-(trifluoromethyl)benzoate (CAS 117324-58-0) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: methyl 2-amino-5-(trifluoromethyl)benzoate. InChIKey: QGFUDNJZHZNPCS-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | methyl 2-amino-5-(trifluoromethyl)benzoate |
| InChIKey | QGFUDNJZHZNPCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)