cas: 1823895-39-1 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-bromo-4-methylnicotinate 98% (CAS 1823895-39-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1272122-100mg |
| cas | 1823895-39-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 5137.44 Pln | |
| Ambeed | 10g | 8680.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1272122 |
Methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate (CAS 1823895-39-1) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate. InChIKey: DIXIPKFJIROFMK-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate |
| InChIKey | DIXIPKFJIROFMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)N)C(=O)OC |
Computed by PubChem (NCBI)