cas: 1247936-83-9 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-fluoro-3-methoxybenzoate, 98% (CAS 1247936-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A330767-1g |
| cas | 1247936-83-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 11722.90 Pln | |
| Fluorochem | 250mg | 3382.16 Pln | |
| Fluorochem | 1g | 7307.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-amino-5-fluoro-3-methoxybenzoate (CAS 1247936-83-9) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: methyl 2-amino-5-fluoro-3-methoxybenzoate. InChIKey: BEWQCUSBIQLPDS-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | methyl 2-amino-5-fluoro-3-methoxybenzoate |
| InChIKey | BEWQCUSBIQLPDS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1N)C(=O)OC)F |
Computed by PubChem (NCBI)