cas: 24237-34-1 — see every product listed under this CAS number, including other names
Methyl 2-amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate (CAS 24237-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021558-1G |
| cas | 24237-34-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 2.5g | 174.96 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl 2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (CAS 24237-34-1) is a chemical compound with the molecular formula C16H18N2O2S and a molecular weight of 302.4 g/mol. IUPAC name: methyl 2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate. InChIKey: QKWWVWMPMBDFBM-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | methyl 2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| InChIKey | QKWWVWMPMBDFBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC2=C1CCN(C2)CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)