CAS 17336-66-2 is the registry number for 1-Propiophenone tosylhydrazone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-methyl-N-[(E)-1-phenylpropylideneamino]benzenesulfonamide (CAS 17336-66-2) is a chemical compound with the molecular formula C16H18N2O2S and a molecular weight of 302.4 g/mol. IUPAC name: 4-methyl-N-[(E)-1-phenylpropylideneamino]benzenesulfonamide. InChIKey: TWTWWQDWKPRWFI-WUKNDPDISA-N.
| Molecular formula | C16H18N2O2S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-1-phenylpropylideneamino]benzenesulfonamide |
| InChIKey | TWTWWQDWKPRWFI-WUKNDPDISA-N |
| SMILES | CC/C(=N\NS(=O)(=O)C1=CC=C(C=C1)C)/C2=CC=CC=C2 |
Computed by PubChem (NCBI)