CAS 1206969-53-0 is the registry number for 2-(4-((Piperidin-1-yl)methyl)phenyl)thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[4-(piperidin-1-ylmethyl)phenyl]-1,3-thiazole-5-carboxylic acid (CAS 1206969-53-0) is a chemical compound with the molecular formula C16H18N2O2S and a molecular weight of 302.4 g/mol. IUPAC name: 2-[4-(piperidin-1-ylmethyl)phenyl]-1,3-thiazole-5-carboxylic acid. InChIKey: CCYNINHTEJXLLS-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-[4-(piperidin-1-ylmethyl)phenyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | CCYNINHTEJXLLS-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC=C(C=C2)C3=NC=C(S3)C(=O)O |
Computed by PubChem (NCBI)