cas: 1228095-06-4 — see every product listed under this CAS number, including other names
Methyl 2-benzyloxy-4-bromobenzoate (CAS 1228095-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JIP-100mg |
| cas | 1228095-06-4 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1216.40 Pln |
| delivery time | 3 weeks |
|---|
Methyl 4-bromo-2-phenylmethoxybenzoate (CAS 1228095-06-4) is a chemical compound with the molecular formula C15H13BrO3 and a molecular weight of 321.16 g/mol. IUPAC name: methyl 4-bromo-2-phenylmethoxybenzoate. InChIKey: SNTOIDUPMITSEP-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO3 |
|---|---|
| Molecular weight | 321.16 g/mol |
| IUPAC name | methyl 4-bromo-2-phenylmethoxybenzoate |
| InChIKey | SNTOIDUPMITSEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)