CAS 17054-26-1 is the registry number for Methyl 3-(benzyloxy)-4-bromobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
Methyl 4-bromo-3-phenylmethoxybenzoate (CAS 17054-26-1) is a chemical compound with the molecular formula C15H13BrO3 and a molecular weight of 321.16 g/mol. IUPAC name: methyl 4-bromo-3-phenylmethoxybenzoate. InChIKey: TWPVBFXEQDHUPX-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO3 |
|---|---|
| Molecular weight | 321.16 g/mol |
| IUPAC name | methyl 4-bromo-3-phenylmethoxybenzoate |
| InChIKey | TWPVBFXEQDHUPX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)