CAS 431052-32-3 is the registry number for Methyl 5-(benzyloxy)-2-bromobenzoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 10g.
Methyl 2-bromo-5-phenylmethoxybenzoate (CAS 431052-32-3) is a chemical compound with the molecular formula C15H13BrO3 and a molecular weight of 321.16 g/mol. IUPAC name: methyl 2-bromo-5-phenylmethoxybenzoate. InChIKey: KLDGAVFZSVMKKB-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO3 |
|---|---|
| Molecular weight | 321.16 g/mol |
| IUPAC name | methyl 2-bromo-5-phenylmethoxybenzoate |
| InChIKey | KLDGAVFZSVMKKB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)