cas: 99552-78-0 — see every product listed under this CAS number, including other names
Methyl 2-bromo-2-(2-methoxyphenyl)acetate 95% (CAS 99552-78-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A864000-250mg |
| cas | 99552-78-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1316.00 Pln | |
| Ambeed | 5g | 3835.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A864000 |
Methyl 2-bromo-2-(2-methoxyphenyl)acetate (CAS 99552-78-0) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 2-bromo-2-(2-methoxyphenyl)acetate. InChIKey: UBXWFYGCGHBNAP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 2-bromo-2-(2-methoxyphenyl)acetate |
| InChIKey | UBXWFYGCGHBNAP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(C(=O)OC)Br |
Computed by PubChem (NCBI)