cas: 144740-56-7 — see every product listed under this CAS number, including other names
Methyl 2-bromo-6-(trifluoromethyl)nicotinate 95% (CAS 144740-56-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A773417-100mg |
| cas | 144740-56-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2322.81 Pln | |
| Ambeed | 10g | 4075.00 Pln | |
| Ambeed | 25g | 8085.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A773417 |
Methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 144740-56-7) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: PEEBGPINNABOSD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | PEEBGPINNABOSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)