cas: 144740-56-7 — see every product listed under this CAS number, including other names
METHYL 2-BROMO-6-(TRIFLUOROMETHYL)NICOTINATE, 97% (CAS 144740-56-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F831034-100MG |
| cas | 144740-56-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 2257.56 Pln | |
| Fluorochem | 10g | 3975.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 144740-56-7) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: PEEBGPINNABOSD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | PEEBGPINNABOSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)