CAS 2091158-96-0 is the registry number for 1-(1-Bromo-2,2,2-trifluoroethyl)-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-bromo-2,2,2-trifluoroethyl)-4-nitrobenzene (CAS 2091158-96-0) is a chemical compound with the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. IUPAC name: 1-(1-bromo-2,2,2-trifluoroethyl)-4-nitrobenzene. InChIKey: PCSJGOCYMGKERD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO2 |
|---|---|
| Molecular weight | 284.03 g/mol |
| IUPAC name | 1-(1-bromo-2,2,2-trifluoroethyl)-4-nitrobenzene |
| InChIKey | PCSJGOCYMGKERD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)