CAS 339151-88-1 appears in our catalog under these names: Methyl 2-chloro-4,6-dimethylnicotinate, 95%, Methyl 2-chloro-4,6-dimethylnicotinate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 0,5g.
Methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate (CAS 339151-88-1) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate. InChIKey: JIWYJFSOPRWMOF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| InChIKey | JIWYJFSOPRWMOF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)OC)Cl)C |
Computed by PubChem (NCBI)