cas: 1073339-13-5 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98% (CAS 1073339-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A698319-100mg |
| cas | 1073339-13-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A698319 |
Methyl 2-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1073339-13-5) is a chemical compound with the molecular formula C14H17BClFO4 and a molecular weight of 314.54 g/mol. IUPAC name: methyl 2-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VRDUKQDRPFLJPG-UHFFFAOYSA-N.
| Molecular formula | C14H17BClFO4 |
|---|---|
| Molecular weight | 314.54 g/mol |
| IUPAC name | methyl 2-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VRDUKQDRPFLJPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)Cl)C(=O)OC |
Computed by PubChem (NCBI)