CAS 2096332-12-4 appears in our catalog under these names: 3-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 98%, 3-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Methyl 3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2096332-12-4) is a chemical compound with the molecular formula C14H17BClFO4 and a molecular weight of 314.54 g/mol. IUPAC name: methyl 3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GWNVQZMLGUYNGG-UHFFFAOYSA-N.
| Molecular formula | C14H17BClFO4 |
|---|---|
| Molecular weight | 314.54 g/mol |
| IUPAC name | methyl 3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GWNVQZMLGUYNGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)Cl)C(=O)OC |
Computed by PubChem (NCBI)