CAS 2581798-50-5 is the registry number for Methyl 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2581798-50-5) is a chemical compound with the molecular formula C14H17BClFO4 and a molecular weight of 314.54 g/mol. IUPAC name: methyl 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: AKUNYLOLMHQMGV-UHFFFAOYSA-N.
| Molecular formula | C14H17BClFO4 |
|---|---|
| Molecular weight | 314.54 g/mol |
| IUPAC name | methyl 2-chloro-5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | AKUNYLOLMHQMGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2Cl)C(=O)OC)F |
Computed by PubChem (NCBI)