cas: 625470-33-9 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98% (CAS 625470-33-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696684-1G |
| cas | 625470-33-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1455.76 Pln | |
| Fluorochem | 25g | 5188.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 625470-33-9) is a chemical compound with the molecular formula C14H18BClO4 and a molecular weight of 296.55 g/mol. IUPAC name: methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: XXYMDCFDGJPULO-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO4 |
|---|---|
| Molecular weight | 296.55 g/mol |
| IUPAC name | methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | XXYMDCFDGJPULO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)