CAS 1980783-96-7 is the registry number for Methyl 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1980783-96-7) is a chemical compound with the molecular formula C14H18BClO4 and a molecular weight of 296.55 g/mol. IUPAC name: methyl 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GUMXBRZEDJLNNF-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO4 |
|---|---|
| Molecular weight | 296.55 g/mol |
| IUPAC name | methyl 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GUMXBRZEDJLNNF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)