CAS 1334019-92-9 appears in our catalog under these names: 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl carbonochloridate, 97%, 97%, Carbonochloridic acid, [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl ester, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbonochloridate (CAS 1334019-92-9) is a chemical compound with the molecular formula C14H18BClO4 and a molecular weight of 296.55 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbonochloridate. InChIKey: RRWXWRCAEZWWCE-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO4 |
|---|---|
| Molecular weight | 296.55 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl carbonochloridate |
| InChIKey | RRWXWRCAEZWWCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)COC(=O)Cl |
Computed by PubChem (NCBI)