CAS 2089325-10-8 is the registry number for Methyl 2-chloro-5-methoxy-4-methylbenzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-chloro-5-methoxy-4-methylbenzoate (CAS 2089325-10-8) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: methyl 2-chloro-5-methoxy-4-methylbenzoate. InChIKey: WZHTWVAPTPUVDI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | methyl 2-chloro-5-methoxy-4-methylbenzoate |
| InChIKey | WZHTWVAPTPUVDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C(=O)OC)Cl |
Computed by PubChem (NCBI)