cas: 220162-64-1 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-4-(trifluoromethyl)benzoate, 98%, 98% (CAS 220162-64-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIX8-100mg |
| cas | 220162-64-1 |
| size | 100mg |
| availability | 31.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 25g | 2195.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-fluoro-4-(trifluoromethyl)benzoate (CAS 220162-64-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: methyl 2-fluoro-4-(trifluoromethyl)benzoate. InChIKey: QCBVUHGECYPLFY-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | methyl 2-fluoro-4-(trifluoromethyl)benzoate |
| InChIKey | QCBVUHGECYPLFY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)