cas: 753924-48-0 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-4-methyl-5-nitrobenzoate 95% (CAS 753924-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A866928-100mg |
| cas | 753924-48-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln | |
| Ambeed | 10g | 3902.56 Pln | |
| Ambeed | 25g | 7618.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A866928 |
Methyl 2-fluoro-4-methyl-5-nitrobenzoate (CAS 753924-48-0) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: methyl 2-fluoro-4-methyl-5-nitrobenzoate. InChIKey: GBECACDDVVYBHV-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | methyl 2-fluoro-4-methyl-5-nitrobenzoate |
| InChIKey | GBECACDDVVYBHV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])C(=O)OC)F |
Computed by PubChem (NCBI)