cas: 2145093-93-0 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-5-isopropoxynicotinate, 98% (CAS 2145093-93-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1656592-5g |
| cas | 2145093-93-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15557.29 Pln | |
| AmBeed | 25g | 51948.19 Pln | |
| AmBeed | 10g | 26474.56 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-fluoro-5-propan-2-yloxypyridine-3-carboxylate (CAS 2145093-93-0) is a chemical compound with the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. IUPAC name: methyl 2-fluoro-5-propan-2-yloxypyridine-3-carboxylate. InChIKey: HGGZHOXOSVUKNY-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO3 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | methyl 2-fluoro-5-propan-2-yloxypyridine-3-carboxylate |
| InChIKey | HGGZHOXOSVUKNY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(N=C1)F)C(=O)OC |
Computed by PubChem (NCBI)