Products 1259981-29-7

CAS 1259981-29-7 is the registry number for 2-Amino-3-(4-fluoro-3-methoxyphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-amino-3-(4-fluoro-3-methoxyphenyl)propanoic acid (CAS 1259981-29-7) is a chemical compound with the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. IUPAC name: 2-amino-3-(4-fluoro-3-methoxyphenyl)propanoic acid. InChIKey: CHRWRFACJVKRNT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12FNO3
Molecular weight213.21 g/mol
IUPAC name2-amino-3-(4-fluoro-3-methoxyphenyl)propanoic acid
InChIKeyCHRWRFACJVKRNT-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)CC(C(=O)O)N)F

Computed by PubChem (NCBI)