CAS 1394957-34-6 is the registry number for 1-Fluoro-2-methyl-4-nitro-5-(propan-2-yloxy)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
1-fluoro-2-methyl-4-nitro-5-propan-2-yloxybenzene (CAS 1394957-34-6) is a chemical compound with the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. IUPAC name: 1-fluoro-2-methyl-4-nitro-5-propan-2-yloxybenzene. InChIKey: NSSOSOVHSHJTGE-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO3 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 1-fluoro-2-methyl-4-nitro-5-propan-2-yloxybenzene |
| InChIKey | NSSOSOVHSHJTGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)OC(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)