Products 1423026-48-5

CAS 1423026-48-5 is the registry number for Methyl 2-hydroxy-2-(piperidin-4-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-2-piperidin-4-ylacetate;hydrochloride (CAS 1423026-48-5) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl 2-hydroxy-2-piperidin-4-ylacetate;hydrochloride. InChIKey: PWPBOVPXRJZHTF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC namemethyl 2-hydroxy-2-piperidin-4-ylacetate;hydrochloride
InChIKeyPWPBOVPXRJZHTF-UHFFFAOYSA-N
SMILESCOC(=O)C(C1CCNCC1)O.Cl

Computed by PubChem (NCBI)