CAS 131651-14-4 appears in our catalog under these names: Ethyl cis-5-amino-tetrahydro-pyran-2-carboxylate, 95%, Ethyl cis-5-amino-tetrahydro-pyran-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
Ethyl (2R,5R)-5-aminooxane-2-carboxylate;hydrochloride (CAS 131651-14-4) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: ethyl (2R,5R)-5-aminooxane-2-carboxylate;hydrochloride. InChIKey: KEHHVCKPABURLO-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | ethyl (2R,5R)-5-aminooxane-2-carboxylate;hydrochloride |
| InChIKey | KEHHVCKPABURLO-ZJLYAJKPSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H](CO1)N.Cl |
Computed by PubChem (NCBI)