Products 1992939-83-9

CAS 1992939-83-9 is the registry number for Methyl 4-hydroxy-1-methylpiperidine-4-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-hydroxy-1-methylpiperidine-4-carboxylate;hydrochloride (CAS 1992939-83-9) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl 4-hydroxy-1-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: MHNFUVSPFZWFCX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC namemethyl 4-hydroxy-1-methylpiperidine-4-carboxylate;hydrochloride
InChIKeyMHNFUVSPFZWFCX-UHFFFAOYSA-N
SMILESCN1CCC(CC1)(C(=O)OC)O.Cl

Computed by PubChem (NCBI)