cas: 2061979-44-8 — see every product listed under this CAS number, including other names
Methyl 2-methoxy-5-(pyrrolidin-2-yl)benzoate hydrochloride, 95%, 95% (CAS 2061979-44-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDPC-250mg |
| cas | 2061979-44-8 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1451.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-methoxy-5-pyrrolidin-2-ylbenzoate;hydrochloride (CAS 2061979-44-8) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl 2-methoxy-5-pyrrolidin-2-ylbenzoate;hydrochloride. InChIKey: ISYVOPIRHRZEJD-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | methyl 2-methoxy-5-pyrrolidin-2-ylbenzoate;hydrochloride |
| InChIKey | ISYVOPIRHRZEJD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CCCN2)C(=O)OC.Cl |
Computed by PubChem (NCBI)