cas: 1246765-27-4 — see every product listed under this CAS number, including other names
Methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate, 98% (CAS 1246765-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217062-100MG |
| cas | 1246765-27-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1169.40 Pln | |
| Fluorochem | 250mg | 1934.75 Pln | |
| Fluorochem | 1g | 5079.48 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 1246765-27-4) is a chemical compound with the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. IUPAC name: methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: PZMUSAMVEKGYRK-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO5 |
|---|---|
| Molecular weight | 293.13 g/mol |
| IUPAC name | methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | PZMUSAMVEKGYRK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=C(C=C2)C(=O)OC)OC |
Computed by PubChem (NCBI)