CAS 2027496-50-8 appears in our catalog under these names: 6–(2–Methoxy–2–oxoethoxy)–3–pyridineboronic Acid Pinacol Ester, 6-(2-Methoxy-2-oxoethoxy)-3-pyridineboronic Acid Pinacol Ester, 97%, 97%, Methyl 2-((5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)oxy)acetate, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g.
Methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate (CAS 2027496-50-8) is a chemical compound with the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. IUPAC name: methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate. InChIKey: QMSMRWQJDYUHEC-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO5 |
|---|---|
| Molecular weight | 293.13 g/mol |
| IUPAC name | methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate |
| InChIKey | QMSMRWQJDYUHEC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OCC(=O)OC |
Computed by PubChem (NCBI)