cas: 1190311-14-8 — see every product listed under this CAS number, including other names
Methyl 2-oxo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-5-carboxylate 95% (CAS 1190311-14-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A985386-100mg |
| cas | 1190311-14-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 1099.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A985386 |
Methyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate (CAS 1190311-14-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate. InChIKey: QBNGFGHVDXKDNN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate |
| InChIKey | QBNGFGHVDXKDNN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=C1)NC(=O)C2 |
Computed by PubChem (NCBI)